CAS 1049760-84-0 appears in our catalog under these names: 2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)aniline hydrochloride, 95%, 2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)aniline hydrochloride, 97%, 2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline;hydrochloride (CAS 1049760-84-0) is a chemical compound with the molecular formula C9H8ClF6NO and a molecular weight of 295.61 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: NHBIXROBPOJEQW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF6NO |
|---|---|
| Molecular weight | 295.61 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | NHBIXROBPOJEQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)