CAS 2931876-19-4 appears in our catalog under these names: 2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethan-1-amine hydrochloride, 95%, 2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 2931876-19-4) is a chemical compound with the molecular formula C9H8ClF6NO and a molecular weight of 295.61 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: SLPVLGSILIYKSU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF6NO |
|---|---|
| Molecular weight | 295.61 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | SLPVLGSILIYKSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)