CAS 1391536-24-5 is the registry number for (S)-2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 1391536-24-5) is a chemical compound with the molecular formula C9H8ClF6NO and a molecular weight of 295.61 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: SLPVLGSILIYKSU-FJXQXJEOSA-N.
| Molecular formula | C9H8ClF6NO |
|---|---|
| Molecular weight | 295.61 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | SLPVLGSILIYKSU-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)