CAS 1049764-31-9 appears in our catalog under these names: 2-(Methylamino)-N-(2,3,4-trifluorophenyl)acetamide hydrochloride, 95%, 2-(Methylamino)-N-(2,3,4-trifluorophenyl)acetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(methylamino)-N-(2,3,4-trifluorophenyl)acetamide;hydrochloride (CAS 1049764-31-9) is a chemical compound with the molecular formula C9H10ClF3N2O and a molecular weight of 254.63 g/mol. IUPAC name: 2-(methylamino)-N-(2,3,4-trifluorophenyl)acetamide;hydrochloride. InChIKey: YGMNVBKXWPIPDD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2O |
|---|---|
| Molecular weight | 254.63 g/mol |
| IUPAC name | 2-(methylamino)-N-(2,3,4-trifluorophenyl)acetamide;hydrochloride |
| InChIKey | YGMNVBKXWPIPDD-UHFFFAOYSA-N |
| SMILES | CNCC(=O)NC1=C(C(=C(C=C1)F)F)F.Cl |
Computed by PubChem (NCBI)