CAS 1583752-82-2 appears in our catalog under these names: N-(4-Aminophenyl)-3,3,3-trifluoropropanamide hydrochloride, 95%, N-(4-Aminophenyl)-3,3,3-trifluoropropanamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(4-aminophenyl)-3,3,3-trifluoropropanamide;hydrochloride (CAS 1583752-82-2) is a chemical compound with the molecular formula C9H10ClF3N2O and a molecular weight of 254.63 g/mol. IUPAC name: N-(4-aminophenyl)-3,3,3-trifluoropropanamide;hydrochloride. InChIKey: CAFAWOAJUINFQO-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2O |
|---|---|
| Molecular weight | 254.63 g/mol |
| IUPAC name | N-(4-aminophenyl)-3,3,3-trifluoropropanamide;hydrochloride |
| InChIKey | CAFAWOAJUINFQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC(=O)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)