Products 1421939-34-5
CAS 1421939-34-5 is the registry number for 3-(3-Azabicyclo[3.1.0]hexan-1-yl)-5-(trifluoromethyl)isoxazole hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-azabicyclo[3.1.0]hexan-1-yl)-5-(trifluoromethyl)-1,2-oxazole;hydrochloride (CAS 1421939-34-5) is a chemical compound with the molecular formula C9H10ClF3N2O and a molecular weight of 254.63 g/mol. IUPAC name: 3-(3-azabicyclo[3.1.0]hexan-1-yl)-5-(trifluoromethyl)-1,2-oxazole;hydrochloride. InChIKey: YGEKOGFWARKISK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2O |
|---|---|
| Molecular weight | 254.63 g/mol |
| IUPAC name | 3-(3-azabicyclo[3.1.0]hexan-1-yl)-5-(trifluoromethyl)-1,2-oxazole;hydrochloride |
| InChIKey | YGEKOGFWARKISK-UHFFFAOYSA-N |
| SMILES | C1C2C1(CNC2)C3=NOC(=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)