CAS 1049873-83-7 is the registry number for 6-Fluoro-7-nitro-1,2,3,4-tetrahydroquinolin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-fluoro-7-nitro-3,4-dihydro-1H-quinolin-2-one (CAS 1049873-83-7) is a chemical compound with the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. IUPAC name: 6-fluoro-7-nitro-3,4-dihydro-1H-quinolin-2-one. InChIKey: ZPGNKJBCUGOHJR-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O3 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | 6-fluoro-7-nitro-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | ZPGNKJBCUGOHJR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=CC(=C(C=C21)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)