Products 1049874-06-7
CAS 1049874-06-7 appears in our catalog under these names: Ethyl 1-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydro-1,2,4-triazine-3-carboxylate, 95%, Ethyl 1-(3-nitrophenyl)-6-oxo-1,4,5,6-tetrahydro-1,2,4-triazine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Ethyl 1-(3-nitrophenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxylate (CAS 1049874-06-7) is a chemical compound with the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. IUPAC name: ethyl 1-(3-nitrophenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxylate. InChIKey: FPZSNWXAINCYMQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O5 |
|---|---|
| Molecular weight | 292.25 g/mol |
| IUPAC name | ethyl 1-(3-nitrophenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxylate |
| InChIKey | FPZSNWXAINCYMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NCC(=O)N(N1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)