CAS 1258639-89-2 appears in our catalog under these names: 4-((3-Methyl-2,5-dioxoimidazolidin-1-yl)methyl)-3-nitrobenzamide, 95%, 4-((3-Methyl-2,5-dioxoimidazolidin-1-yl)methyl)-3-nitrobenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-nitrobenzamide (CAS 1258639-89-2) is a chemical compound with the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. IUPAC name: 4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-nitrobenzamide. InChIKey: WXPPXTSPYJZZET-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O5 |
|---|---|
| Molecular weight | 292.25 g/mol |
| IUPAC name | 4-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-nitrobenzamide |
| InChIKey | WXPPXTSPYJZZET-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)N(C1=O)CC2=C(C=C(C=C2)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)