CAS 2183487-92-3 is the registry number for 2’-Beta-C-Ethynyl inosine. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
9-[(2R,3R,4R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 2183487-92-3) is a chemical compound with the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. IUPAC name: 9-[(2R,3R,4R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: RSQIETLALZCXER-YUTYNTIBSA-N.
| Molecular formula | C12H12N4O5 |
|---|---|
| Molecular weight | 292.25 g/mol |
| IUPAC name | 9-[(2R,3R,4R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | RSQIETLALZCXER-YUTYNTIBSA-N |
| SMILES | C#C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C2N=CNC3=O)CO)O)O |
Computed by PubChem (NCBI)