CAS 1049978-93-9 appears in our catalog under these names: Trans-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid hydrochloride, 97%, trans–4–(4–Methoxyphenyl)pyrrolidine–3–carboxylic acid hydrochloride, trans-4-(4-Methoxyphenyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 500mg, 2.5g.
(3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049978-93-9) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: (3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: XNGVHGXCWZSSEN-DHXVBOOMSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | (3R,4S)-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | XNGVHGXCWZSSEN-DHXVBOOMSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2CNC[C@@H]2C(=O)O.Cl |
Computed by PubChem (NCBI)