Products 10500-89-7
CAS 10500-89-7 is the registry number for 6,7-Diisobutoxy-4-hydroxyquinoline-3-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
6,7-bis(2-methylpropoxy)-4-oxo-1H-quinoline-3-carboxylic acid (CAS 10500-89-7) is a chemical compound with the molecular formula C18H23NO5 and a molecular weight of 333.4 g/mol. IUPAC name: 6,7-bis(2-methylpropoxy)-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: CSEPFVXJYRWNMR-UHFFFAOYSA-N.
| Molecular formula | C18H23NO5 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 6,7-bis(2-methylpropoxy)-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | CSEPFVXJYRWNMR-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)O)OCC(C)C |
Computed by PubChem (NCBI)