Products 1440526-59-9

CAS 1440526-59-9 is the registry number for 2-tert-Butoxycarbonyloxy-indole-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate (CAS 1440526-59-9) is a chemical compound with the molecular formula C18H23NO5 and a molecular weight of 333.4 g/mol. IUPAC name: tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate. InChIKey: WEQQFQSTEHLHCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H23NO5
Molecular weight333.4 g/mol
IUPAC nametert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]indole-1-carboxylate
InChIKeyWEQQFQSTEHLHCZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1OC(=O)OC(C)(C)C

Computed by PubChem (NCBI)