Products 2358438-57-8
CAS 2358438-57-8 is the registry number for tert-Butyl 2-(3-(methoxycarbonyl)-5-methylphenyl)-4-oxopyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(3-methoxycarbonyl-5-methylphenyl)-4-oxopyrrolidine-1-carboxylate (CAS 2358438-57-8) is a chemical compound with the molecular formula C18H23NO5 and a molecular weight of 333.4 g/mol. IUPAC name: tert-butyl 2-(3-methoxycarbonyl-5-methylphenyl)-4-oxopyrrolidine-1-carboxylate. InChIKey: NPNQAYKXFMJMBR-UHFFFAOYSA-N.
| Molecular formula | C18H23NO5 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | tert-butyl 2-(3-methoxycarbonyl-5-methylphenyl)-4-oxopyrrolidine-1-carboxylate |
| InChIKey | NPNQAYKXFMJMBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)OC)C2CC(=O)CN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)