Products 1050480-30-2
CAS 1050480-30-2 appears in our catalog under these names: PhiKan 083 hydrochloride, 1-(9-Ethyl-9H-carbazol-3-yl)-N-methylmethanamine hydrochloride, 99%, 99%, PhiKan 083 hydrochloride, 99.27%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 0,5g, 5mg, 25mg, 100mg, 25 mg, 100 mg.
1-(9-ethylcarbazol-3-yl)-N-methylmethanamine;hydrochloride (CAS 1050480-30-2) is a chemical compound with the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. IUPAC name: 1-(9-ethylcarbazol-3-yl)-N-methylmethanamine;hydrochloride. InChIKey: IXWVUPURFWFRNE-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2 |
|---|---|
| Molecular weight | 274.79 g/mol |
| IUPAC name | 1-(9-ethylcarbazol-3-yl)-N-methylmethanamine;hydrochloride |
| InChIKey | IXWVUPURFWFRNE-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)CNC)C3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)
Synonyms:
PhiKan083 hydrochloride, PhiKan 083 hydrochloride, 1-(9-ethyl-9H-carbazol-3-yl)-N-methylmethanamine hydrochloride, PhiKan 083 HCl, PhiKan-083, 9-Ethyl-N-methyl-9H-carbazole-3-methanamine hydrochloride, 1-(9-ethylcarbazol-3-yl)-N-methylmethanamine;hydrochloride, phikan083, [(9-ethyl-9H-carbazol-3-yl)methyl](methyl)amine hydrochloride, PhiKan-083 HCl