CAS 78164-59-7 is the registry number for 2-Methyl-4-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride (CAS 78164-59-7) is a chemical compound with the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. IUPAC name: 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride. InChIKey: QVRVDOKQQXBOLD-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2 |
|---|---|
| Molecular weight | 274.79 g/mol |
| IUPAC name | 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-amine;hydrochloride |
| InChIKey | QVRVDOKQQXBOLD-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(C1)C(=CC=C2)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)