CAS 1965305-27-4 is the registry number for 1-Benzhydrylazetidin-3-amine hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 100mg.
1-benzhydrylazetidin-3-amine;hydrochloride (CAS 1965305-27-4) is a chemical compound with the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. IUPAC name: 1-benzhydrylazetidin-3-amine;hydrochloride. InChIKey: AMEKOBTVZHDIFP-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2 |
|---|---|
| Molecular weight | 274.79 g/mol |
| IUPAC name | 1-benzhydrylazetidin-3-amine;hydrochloride |
| InChIKey | AMEKOBTVZHDIFP-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)