Products 1050482-18-2

CAS 1050482-18-2 is the registry number for Ropivacaine Impurity 16. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R)-N-(2,6-dimethylphenyl)-1-propan-2-ylpiperidine-2-carboxamide (CAS 1050482-18-2) is a chemical compound with the molecular formula C17H26N2O and a molecular weight of 274.4 g/mol. IUPAC name: (2R)-N-(2,6-dimethylphenyl)-1-propan-2-ylpiperidine-2-carboxamide. InChIKey: DLKZMUOUUWXTAZ-OAHLLOKOSA-N.

Identity
Molecular formulaC17H26N2O
Molecular weight274.4 g/mol
IUPAC name(2R)-N-(2,6-dimethylphenyl)-1-propan-2-ylpiperidine-2-carboxamide
InChIKeyDLKZMUOUUWXTAZ-OAHLLOKOSA-N
SMILESCC1=C(C(=CC=C1)C)NC(=O)[C@H]2CCCCN2C(C)C

Computed by PubChem (NCBI)