Products 1392208-04-6
CAS 1392208-04-6 appears in our catalog under these names: (±)-Ropivacaine-d7 (propyl-d7), 98 atom % D, min 98% Chemical Purity, (Rac)-Ropivacaine-d7, 99.60%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 25 mg, 1 mg, 10 mg.
N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide (CAS 1392208-04-6) is a chemical compound with the molecular formula C17H26N2O and a molecular weight of 281.44 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide. InChIKey: ZKMNUMMKYBVTFN-JNIQENOFSA-N.
| Molecular formula | C17H26N2O |
|---|---|
| Molecular weight | 281.44 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide |
| InChIKey | ZKMNUMMKYBVTFN-JNIQENOFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N1CCCCC1C(=O)NC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)