CAS 684647-62-9 appears in our catalog under these names: Ropivacaine-d7, Ropivacaine–d7, Ropivacaine-d7, 99%, 99%, Ropivacaine-d7, 99.69%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 1 mg, 10 mg, 5 mg.
(2S)-N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide (CAS 684647-62-9) is a chemical compound with the molecular formula C17H26N2O and a molecular weight of 281.44 g/mol. IUPAC name: (2S)-N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide. InChIKey: ZKMNUMMKYBVTFN-YMXBPWPKSA-N.
| Molecular formula | C17H26N2O |
|---|---|
| Molecular weight | 281.44 g/mol |
| IUPAC name | (2S)-N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide |
| InChIKey | ZKMNUMMKYBVTFN-YMXBPWPKSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N1CCCC[C@H]1C(=O)NC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)