CAS 1050590-36-7 appears in our catalog under these names: 5-(Aminomethyl)-2-pyrrolidinone oxalate, 95%, 5-(Aminomethyl)pyrrolidin-2-one oxalate, 97%, 5–(Aminomethyl)pyrrolidin–2–one oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
5-(aminomethyl)pyrrolidin-2-one;oxalic acid (CAS 1050590-36-7) is a chemical compound with the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. IUPAC name: 5-(aminomethyl)pyrrolidin-2-one;oxalic acid. InChIKey: UBTSELAHPNEMDE-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O5 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 5-(aminomethyl)pyrrolidin-2-one;oxalic acid |
| InChIKey | UBTSELAHPNEMDE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)