CAS 16639-91-1 appears in our catalog under these names: N(Alpha)-ethoxycarbonyl-l-asparagine, 95%, (S)-4-Amino-2-((ethoxycarbonyl)amino)-4-oxobutanoic acid, 97%, (S)-4-Amino-2-((ethoxycarbonyl)amino)-4-oxobutanoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 500g.
(2S)-4-amino-2-(ethoxycarbonylamino)-4-oxobutanoic acid (CAS 16639-91-1) is a chemical compound with the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. IUPAC name: (2S)-4-amino-2-(ethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: YORYXPTWPIKBDE-BYPYZUCNSA-N.
| Molecular formula | C7H12N2O5 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (2S)-4-amino-2-(ethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | YORYXPTWPIKBDE-BYPYZUCNSA-N |
| SMILES | CCOC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)