CAS 3244-65-3 appears in our catalog under these names: Acetyl-L-serylglycine, Ac–Ser–Gly–OH, Ac-Ser-Gly-OH. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]acetic acid (CAS 3244-65-3) is a chemical compound with the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. IUPAC name: 2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]acetic acid. InChIKey: DZSFFSREGMDONQ-YFKPBYRVSA-N.
| Molecular formula | C7H12N2O5 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]acetic acid |
| InChIKey | DZSFFSREGMDONQ-YFKPBYRVSA-N |
| SMILES | CC(=O)N[C@@H](CO)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)