Products 1050631-82-7
CAS 1050631-82-7 is the registry number for Ezetimibe tetrahydropyran analog. Offered by: Chemat Brand. Available pack sizes: on request.
N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide (CAS 1050631-82-7) is a chemical compound with the molecular formula C24H21F2NO3 and a molecular weight of 409.4 g/mol. IUPAC name: N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide. InChIKey: IBDXWUJVRNPFPE-UHFFFAOYSA-N.
| Molecular formula | C24H21F2NO3 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | N,6-bis(4-fluorophenyl)-2-(4-hydroxyphenyl)oxane-3-carboxamide |
| InChIKey | IBDXWUJVRNPFPE-UHFFFAOYSA-N |
| SMILES | C1CC(OC(C1C(=O)NC2=CC=C(C=C2)F)C3=CC=C(C=C3)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)