Products 1050912-62-3
CAS 1050912-62-3 appears in our catalog under these names: 5–((4–Carboxybenzyl)oxy)isophthalic acid, 5-((4-Carboxybenzyl)oxy)isophthalic acid, 97%, 5-((4-Carboxybenzyl)oxy)isophthalic acid, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-[(4-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid (CAS 1050912-62-3) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 5-[(4-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid. InChIKey: GOZATJNCMKPSAV-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 5-[(4-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid |
| InChIKey | GOZATJNCMKPSAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)