CAS 1051392-53-0 appears in our catalog under these names: Mexiletine Impurity 3, (E)-1-(2,6-Dimethylphenoxy)propan-2-one Oxime. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
(NE)-N-[1-(2,6-dimethylphenoxy)propan-2-ylidene]hydroxylamine (CAS 1051392-53-0) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (NE)-N-[1-(2,6-dimethylphenoxy)propan-2-ylidene]hydroxylamine. InChIKey: DJQNMCARGAAZBX-ZRDIBKRKSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (NE)-N-[1-(2,6-dimethylphenoxy)propan-2-ylidene]hydroxylamine |
| InChIKey | DJQNMCARGAAZBX-ZRDIBKRKSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC/C(=N/O)/C |
Computed by PubChem (NCBI)