CAS 105219-75-8 is the registry number for (5,6-Dimethyl-4-oxo-3,4-dihydro-thieno[2,3-d]pyrimidin-2-yl)-acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
Methyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetate (CAS 105219-75-8) is a chemical compound with the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. IUPAC name: methyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetate. InChIKey: HAHGFZCGLMLOCV-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3S |
|---|---|
| Molecular weight | 252.29 g/mol |
| IUPAC name | methyl 2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)acetate |
| InChIKey | HAHGFZCGLMLOCV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)CC(=O)OC)C |
Computed by PubChem (NCBI)