Products 120729-84-2
CAS 120729-84-2 is the registry number for 3-Formyl-n,n-dimethyl-1h-indole-5-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide (CAS 120729-84-2) is a chemical compound with the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. IUPAC name: 3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide. InChIKey: HNUWCNMXPWIDOC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3S |
|---|---|
| Molecular weight | 252.29 g/mol |
| IUPAC name | 3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide |
| InChIKey | HNUWCNMXPWIDOC-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)NC=C2C=O |
Computed by PubChem (NCBI)