CAS 326610-71-3 is the registry number for 3-Amino-n-(furan-2-ylmethyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-amino-N-(furan-2-ylmethyl)benzenesulfonamide (CAS 326610-71-3) is a chemical compound with the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. IUPAC name: 3-amino-N-(furan-2-ylmethyl)benzenesulfonamide. InChIKey: HGEBFZLOXJIJHK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3S |
|---|---|
| Molecular weight | 252.29 g/mol |
| IUPAC name | 3-amino-N-(furan-2-ylmethyl)benzenesulfonamide |
| InChIKey | HGEBFZLOXJIJHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCC2=CC=CO2)N |
Computed by PubChem (NCBI)