Products 1052228-70-2
CAS 1052228-70-2 is the registry number for Virosine B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
15-hydroxy-13-oxa-7-azatetracyclo[6.5.2.01,10.02,7]pentadec-10-en-12-one (CAS 1052228-70-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 15-hydroxy-13-oxa-7-azatetracyclo[6.5.2.01,10.02,7]pentadec-10-en-12-one. InChIKey: SVHWKXNNRMAUAN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 15-hydroxy-13-oxa-7-azatetracyclo[6.5.2.01,10.02,7]pentadec-10-en-12-one |
| InChIKey | SVHWKXNNRMAUAN-UHFFFAOYSA-N |
| SMILES | C1CCN2C(C1)C34CC(C2CC3=CC(=O)O4)O |
Computed by PubChem (NCBI)