CAS 1052418-36-6 is the registry number for Tetrahydro-N-(tetrahydro-1,1-dioxido-3-thienyl)-2-furanmethanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-N-(oxolan-2-ylmethyl)thiolan-3-amine;hydrochloride (CAS 1052418-36-6) is a chemical compound with the molecular formula C9H18ClNO3S and a molecular weight of 255.76 g/mol. IUPAC name: 1,1-dioxo-N-(oxolan-2-ylmethyl)thiolan-3-amine;hydrochloride. InChIKey: HOMVDAVYCAXHAZ-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO3S |
|---|---|
| Molecular weight | 255.76 g/mol |
| IUPAC name | 1,1-dioxo-N-(oxolan-2-ylmethyl)thiolan-3-amine;hydrochloride |
| InChIKey | HOMVDAVYCAXHAZ-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC2CCS(=O)(=O)C2.Cl |
Computed by PubChem (NCBI)