CAS 2260936-82-9 is the registry number for 8-Amino-2-(hydroxymethyl)-5λ6-thiaspiro(3.5)nonane-5,5-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-2-yl)methanol;hydrochloride (CAS 2260936-82-9) is a chemical compound with the molecular formula C9H18ClNO3S and a molecular weight of 255.76 g/mol. IUPAC name: (8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-2-yl)methanol;hydrochloride. InChIKey: LCFIDLHXPMWACY-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO3S |
|---|---|
| Molecular weight | 255.76 g/mol |
| IUPAC name | (8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-2-yl)methanol;hydrochloride |
| InChIKey | LCFIDLHXPMWACY-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2(CC1N)CC(C2)CO.Cl |
Computed by PubChem (NCBI)