CAS 2253639-03-9 is the registry number for 4-Amino-1-oxa-9λâ¶-thiaspiro(5.5)undecane-9,9-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-amine;hydrochloride (CAS 2253639-03-9) is a chemical compound with the molecular formula C9H18ClNO3S and a molecular weight of 255.76 g/mol. IUPAC name: 9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-amine;hydrochloride. InChIKey: WAOQAWZCKYHMKS-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO3S |
|---|---|
| Molecular weight | 255.76 g/mol |
| IUPAC name | 9,9-dioxo-1-oxa-9lambda6-thiaspiro[5.5]undecan-4-amine;hydrochloride |
| InChIKey | WAOQAWZCKYHMKS-UHFFFAOYSA-N |
| SMILES | C1COC2(CCS(=O)(=O)CC2)CC1N.Cl |
Computed by PubChem (NCBI)