CAS 1052420-41-3 is the registry number for N-(sec-Butyl)tetrahydrothiophen-3-amine 1,1-dioxide hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
N-butan-2-yl-1,1-dioxothiolan-3-amine;hydrochloride (CAS 1052420-41-3) is a chemical compound with the molecular formula C8H18ClNO2S and a molecular weight of 227.75 g/mol. IUPAC name: N-butan-2-yl-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: IXWFBNUFUMAENN-UHFFFAOYSA-N.
| Molecular formula | C8H18ClNO2S |
|---|---|
| Molecular weight | 227.75 g/mol |
| IUPAC name | N-butan-2-yl-1,1-dioxothiolan-3-amine;hydrochloride |
| InChIKey | IXWFBNUFUMAENN-UHFFFAOYSA-N |
| SMILES | CCC(C)NC1CCS(=O)(=O)C1.Cl |
Computed by PubChem (NCBI)