CAS 1909306-66-6 appears in our catalog under these names: 3-(tert-Butyl)thiomorpholine 1,1-dioxide hydrochloride, 98%, 3-​(1,​1-​Dimethylethyl)​-​thiomorpholine 1,​1-​dioxide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
3-tert-butyl-1,4-thiazinane 1,1-dioxide;hydrochloride (CAS 1909306-66-6) is a chemical compound with the molecular formula C8H18ClNO2S and a molecular weight of 227.75 g/mol. IUPAC name: 3-tert-butyl-1,4-thiazinane 1,1-dioxide;hydrochloride. InChIKey: WRJONYOSEKVTNK-UHFFFAOYSA-N.
| Molecular formula | C8H18ClNO2S |
|---|---|
| Molecular weight | 227.75 g/mol |
| IUPAC name | 3-tert-butyl-1,4-thiazinane 1,1-dioxide;hydrochloride |
| InChIKey | WRJONYOSEKVTNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CS(=O)(=O)CCN1.Cl |
Computed by PubChem (NCBI)