Products 890660-04-5
CAS 890660-04-5 is the registry number for (E)-(3S)-3-Amino-5-methyl-1-(methylsulphonyl)hex-1-ene hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-amine;hydrochloride (CAS 890660-04-5) is a chemical compound with the molecular formula C8H18ClNO2S and a molecular weight of 227.75 g/mol. IUPAC name: (E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-amine;hydrochloride. InChIKey: PVEBAYMGCSDWGH-LBOUNTCOSA-N.
| Molecular formula | C8H18ClNO2S |
|---|---|
| Molecular weight | 227.75 g/mol |
| IUPAC name | (E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-amine;hydrochloride |
| InChIKey | PVEBAYMGCSDWGH-LBOUNTCOSA-N |
| SMILES | CC(C)C[C@@H](/C=C/S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)