CAS 1052538-07-4 is the registry number for 3-(1-(2-Thienyl)-3,4-dihydroisoquinolin-2(1H)-yl)propanoic Acid Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
3-(1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)propanoic acid;hydrochloride (CAS 1052538-07-4) is a chemical compound with the molecular formula C16H18ClNO2S and a molecular weight of 323.8 g/mol. IUPAC name: 3-(1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)propanoic acid;hydrochloride. InChIKey: YBBPGOHNFUZULD-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO2S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 3-(1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)propanoic acid;hydrochloride |
| InChIKey | YBBPGOHNFUZULD-UHFFFAOYSA-N |
| SMILES | C1CN(C(C2=CC=CC=C21)C3=CC=CS3)CCC(=O)O.Cl |
Computed by PubChem (NCBI)