CAS 1346605-15-9 appears in our catalog under these names: Clopidogrel Impurity 25, S-Clopidogrel N-Methyl Impurity, Clopidogrel Impurity 26, Clopidogrel N-Methyl Impurity I HCl. Offered by: Chemat Brand, TRC, Biosynth, Hubei YoungXin. Available pack sizes: on request, 250mg, 25mg, 50mg, 10mg, 100mg, 200mg.
Methyl (2S)-2-(2-chlorophenyl)-2-[methyl(2-thiophen-2-ylethyl)amino]acetate (CAS 1346605-15-9) is a chemical compound with the molecular formula C16H18ClNO2S and a molecular weight of 323.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-[methyl(2-thiophen-2-ylethyl)amino]acetate. InChIKey: ABZKNRNOULMZHY-HNNXBMFYSA-N.
| Molecular formula | C16H18ClNO2S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-[methyl(2-thiophen-2-ylethyl)amino]acetate |
| InChIKey | ABZKNRNOULMZHY-HNNXBMFYSA-N |
| SMILES | CN(CCC1=CC=CS1)[C@@H](C2=CC=CC=C2Cl)C(=O)OC |
Computed by PubChem (NCBI)