CAS 170111-34-9 is the registry number for (E)-(3S)-3-Amino-4-phenyl-1-(phenylsulphonyl)but-1-ene hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-amine;hydrochloride (CAS 170111-34-9) is a chemical compound with the molecular formula C16H18ClNO2S and a molecular weight of 323.8 g/mol. IUPAC name: (E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-amine;hydrochloride. InChIKey: KNAGGDQMEXGKKF-PDNJSEKVSA-N.
| Molecular formula | C16H18ClNO2S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | (E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-amine;hydrochloride |
| InChIKey | KNAGGDQMEXGKKF-PDNJSEKVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](/C=C/S(=O)(=O)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)