CAS 1052541-78-2 appears in our catalog under these names: 1-(1,1-Dioxidotetrahydrothien-3-yl)piperidine-4-carboxylic acid hydrochloride, 95%, 1-(1,1-Dioxidotetrahydrothiophen-3-yl)piperidine-4-carboxylic acid hydrochloride, 98+%, 1-(1,1-Dioxidotetrahydrothien-3-yl)piperidine-4-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g.
1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid;hydrochloride (CAS 1052541-78-2) is a chemical compound with the molecular formula C10H18ClNO4S and a molecular weight of 283.77 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid;hydrochloride. InChIKey: TTZXLLFPKRKVIQ-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO4S |
|---|---|
| Molecular weight | 283.77 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid;hydrochloride |
| InChIKey | TTZXLLFPKRKVIQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2CCS(=O)(=O)C2.Cl |
Computed by PubChem (NCBI)