CAS 2138004-47-2 is the registry number for Methyl 8-amino-5-thiaspiro(3.5)nonane-2-carboxylate 5,5-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 2138004-47-2) is a chemical compound with the molecular formula C10H18ClNO4S and a molecular weight of 283.77 g/mol. IUPAC name: methyl 8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: KNMNKGDYSUTVCU-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO4S |
|---|---|
| Molecular weight | 283.77 g/mol |
| IUPAC name | methyl 8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylate;hydrochloride |
| InChIKey | KNMNKGDYSUTVCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(C1)CC(CCS2(=O)=O)N.Cl |
Computed by PubChem (NCBI)