CAS 2396464-04-1 is the registry number for tert-Butyl ((1R,3R)-3-(chlorosulfonyl)cyclopentyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,3R)-3-chlorosulfonylcyclopentyl]carbamate (CAS 2396464-04-1) is a chemical compound with the molecular formula C10H18ClNO4S and a molecular weight of 283.77 g/mol. IUPAC name: tert-butyl N-[(1R,3R)-3-chlorosulfonylcyclopentyl]carbamate. InChIKey: ZCRZCPFAFYXHEK-HTQZYQBOSA-N.
| Molecular formula | C10H18ClNO4S |
|---|---|
| Molecular weight | 283.77 g/mol |
| IUPAC name | tert-butyl N-[(1R,3R)-3-chlorosulfonylcyclopentyl]carbamate |
| InChIKey | ZCRZCPFAFYXHEK-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)