Products 1052547-17-7

CAS 1052547-17-7 is the registry number for 2-methyl-2-(1H-1,2,4-triazol-1-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride (CAS 1052547-17-7) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: 2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride. InChIKey: UDRIUYPQDJSXML-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClN3O2
Molecular weight191.61 g/mol
IUPAC name2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride
InChIKeyUDRIUYPQDJSXML-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)N1C=NC=N1.Cl

Computed by PubChem (NCBI)