CAS 1052547-17-7 is the registry number for 2-methyl-2-(1H-1,2,4-triazol-1-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride (CAS 1052547-17-7) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: 2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride. InChIKey: UDRIUYPQDJSXML-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | 2-methyl-2-(1,2,4-triazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | UDRIUYPQDJSXML-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=NC=N1.Cl |
Computed by PubChem (NCBI)