Products 2034157-29-2

CAS 2034157-29-2 is the registry number for 5-(Aminomethyl)-1-methylpyrimidine-2,4(1h,3h)-dione hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(aminomethyl)-1-methylpyrimidine-2,4-dione;hydrochloride (CAS 2034157-29-2) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: 5-(aminomethyl)-1-methylpyrimidine-2,4-dione;hydrochloride. InChIKey: VMHVOASAOXEWTG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClN3O2
Molecular weight191.61 g/mol
IUPAC name5-(aminomethyl)-1-methylpyrimidine-2,4-dione;hydrochloride
InChIKeyVMHVOASAOXEWTG-UHFFFAOYSA-N
SMILESCN1C=C(C(=O)NC1=O)CN.Cl

Computed by PubChem (NCBI)