CAS 1187927-35-0 appears in our catalog under these names: 2-(3,5-Dimethyl-1h-1,2,4-triazol-1-yl)acetic acid hydrochloride, 95%, 2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g.
2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetic acid;hydrochloride (CAS 1187927-35-0) is a chemical compound with the molecular formula C6H10ClN3O2 and a molecular weight of 191.61 g/mol. IUPAC name: 2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetic acid;hydrochloride. InChIKey: HLVMFJBXAYCLRA-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2 |
|---|---|
| Molecular weight | 191.61 g/mol |
| IUPAC name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetic acid;hydrochloride |
| InChIKey | HLVMFJBXAYCLRA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C)CC(=O)O.Cl |
Computed by PubChem (NCBI)