CAS 1052552-03-0 is the registry number for 2-Chloro-1-(4-(4-hydroxyphenyl)piperazin-1-yl)ethan-1-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-1-[4-(4-hydroxyphenyl)piperazin-1-yl]ethanone;hydrochloride (CAS 1052552-03-0) is a chemical compound with the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.17 g/mol. IUPAC name: 2-chloro-1-[4-(4-hydroxyphenyl)piperazin-1-yl]ethanone;hydrochloride. InChIKey: QMSYAYGHZHCIHO-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O2 |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | 2-chloro-1-[4-(4-hydroxyphenyl)piperazin-1-yl]ethanone;hydrochloride |
| InChIKey | QMSYAYGHZHCIHO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)O)C(=O)CCl.Cl |
Computed by PubChem (NCBI)