Products 1910051-14-7
CAS 1910051-14-7 appears in our catalog under these names: 2-Chloro-4-(4-methylpiperazin-1-yl)benzoic acid hydrochloride, 95%, 2-Chloro-4-(4-methylpiperazin-1-yl)benzoic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg.
2-chloro-4-(4-methylpiperazin-1-yl)benzoic acid;hydrochloride (CAS 1910051-14-7) is a chemical compound with the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.17 g/mol. IUPAC name: 2-chloro-4-(4-methylpiperazin-1-yl)benzoic acid;hydrochloride. InChIKey: NUTSMIOXCAEEJZ-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O2 |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | 2-chloro-4-(4-methylpiperazin-1-yl)benzoic acid;hydrochloride |
| InChIKey | NUTSMIOXCAEEJZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)