Products 1883548-88-6
CAS 1883548-88-6 appears in our catalog under these names: FFN 206 Dihydrochloride, FFN 206 dihydrochloride/ 100%, FFN 206 dihydrochloride, FFN 206 (dihydrochloride), 99.45%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 50 mg.
4-(2-aminoethyl)-7-(methylamino)chromen-2-one;dihydrochloride (CAS 1883548-88-6) is a chemical compound with the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.17 g/mol. IUPAC name: 4-(2-aminoethyl)-7-(methylamino)chromen-2-one;dihydrochloride. InChIKey: ODENAPXTSFPACZ-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O2 |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | 4-(2-aminoethyl)-7-(methylamino)chromen-2-one;dihydrochloride |
| InChIKey | ODENAPXTSFPACZ-UHFFFAOYSA-N |
| SMILES | CNC1=CC2=C(C=C1)C(=CC(=O)O2)CCN.Cl.Cl |
Computed by PubChem (NCBI)