CAS 1052561-26-8 is the registry number for 3-(1-(1,1-Dioxidotetrahydrothiophen-3-yl)-3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]propanoic acid (CAS 1052561-26-8) is a chemical compound with the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. IUPAC name: 3-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]propanoic acid. InChIKey: OGMBHZHYUKIGDU-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | 3-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]propanoic acid |
| InChIKey | OGMBHZHYUKIGDU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2CCS(=O)(=O)C2)C)CCC(=O)O |
Computed by PubChem (NCBI)