CAS 1845689-87-3 is the registry number for N-(2-Nitrophenyl)-N-pentylmethanesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-nitrophenyl)-N-pentylmethanesulfonamide (CAS 1845689-87-3) is a chemical compound with the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. IUPAC name: N-(2-nitrophenyl)-N-pentylmethanesulfonamide. InChIKey: KRKIEOPXMFOZOX-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | N-(2-nitrophenyl)-N-pentylmethanesulfonamide |
| InChIKey | KRKIEOPXMFOZOX-UHFFFAOYSA-N |
| SMILES | CCCCCN(C1=CC=CC=C1[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)